A7452412
Sodium Cholate , >98.0% , 361-09-1
CAS NO.:361-09-1
Empirical Formula: C24H41NaO5
Molecular Weight: 432.58
MDL number: MFCD00064138
EINECS: 206-643-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB59.20 | In Stock |
|
| 25G | RMB204.80 | In Stock |
|
| 100G | RMB576.00 | In Stock |
|
| 500G | RMB2119.20 | In Stock |
|
| 1kg | RMB4143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >225°C (dec.) |
| alpha | 35 º (c=0.6, ethanol) |
| Density | 0.999 at 20.09℃ |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 35 ° (C=0.6, EtOH) |
| storage temp. | +15C to +30C |
| solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly), Water |
| pka | 5.2 |
| form | Powder |
| color | White to off-white |
| PH | pH (50g/l , 25℃) : 7.0~9.5 |
| Water Solubility | 150 g/L (20 ºC) |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING SKIN PROTECTING |
| InChIKey | NRHMKIHPTBHXPF-TUJRSCDTSA-M |
| SMILES | [Na+].[O-]C(=O)CC[C@H]([C@@H]1[C@@]2([C@H]([C@H]3[C@@H]([C@@]4([C@H](C[C@H]3O)C[C@@H](CC4)O)C)C[C@@H]2O)CC1)C)C |
| LogP | 4.3 at 22℃ and pH5.7 |
| CAS DataBase Reference | 361-09-1(CAS DataBase Reference) |
| EPA Substance Registry System | Cholan-24-oic acid, 3,7,12-trihydroxy-, monosodium salt, (3.alpha.,5.beta.,7.alpha.,12.alpha.)- (361-09-1) |
Description and Uses
Sodium cholate is a non-denaturing detergent used for membrane protein extraction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS | FZ9600000 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 |




