A7452512
Sodium Palmitate , >97.0%(GC)(T) , 408-35-5
Synonym(s):
Hexadecanoic acid sodium salt;Palmitic acid sodium salt
CAS NO.：408-35-5
Empirical Formula: C16H31NaO2
Molecular Weight: 278.41
MDL number: MFCD00002749
EINECS: 206-988-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB88.80 | In Stock |
|
| 5g | RMB159.20 | In Stock |
|
| 25G | RMB508.00 | In Stock |
|
| 100G | RMB1245.60 | In Stock |
|
| 500g | RMB3973.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 283-290 °C (lit.) |
| storage temp. | 2-8°C |
| solubility | very faint turbidity in hot EtOH50vol% |
| form | Powder |
| color | White |
| biological source | plant (palm) |
| BRN | 3575882 |
| InChI | InChI=1S/C16H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1 |
| InChIKey | GGXKEBACDBNFAF-UHFFFAOYSA-M |
| SMILES | C(CCCCC([O-])=O)CCCCCCCCCC.[Na+] |
| LogP | 7.154 (est) |
| CAS DataBase Reference | 408-35-5(CAS DataBase Reference) |
| EPA Substance Registry System | Hexadecanoic acid, sodium salt (408-35-5) |
Description and Uses
Polymerization catalyst for synthetic rubbers, laundry and toilet soaps, detergents, cosmetics, pharmaceuticals, printing inks, and as an emulsi- fier.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P280-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 1 |
| RTECS | RT4945000 |
| HS Code | 29157000 |
| Hazardous Substances Data | 408-35-5(Hazardous Substances Data) |
