A7470912
<SC>L</SC>-C-Propargylglycine , 98% , 23235-01-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB66.40 | In Stock |
|
| 1g | RMB220.80 | In Stock |
|
| 5g | RMB979.20 | In Stock |
|
| 25g | RMB4319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 235-239°C |
| Boiling point: | 272.1±35.0 °C(Predicted) |
| Density | 1.209±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 2.04±0.10(Predicted) |
| form | Powder |
| color | White to pale yellow |
| BRN | 2347861 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h1,4H,3,6H2,(H,7,8)/t4-/m0/s1 |
| InChIKey | DGYHPLMPMRKMPD-BYPYZUCNSA-N |
| SMILES | C(O)(=O)[C@@H](N)CC#C |
| CAS DataBase Reference | 23235-01-0(CAS DataBase Reference) |
Description and Uses
Reagent for the irreversible inactivation of γ-cystathionase; affinity labeling reagent for γ-cystathionase and other enzymes; peptides containing this amino acid can be tritiated to high specific radioactivity
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |



