A7474012
3-Methyl-2-oxobutanoic acid sodium salt , 95% , 3715-29-5
Synonym(s):
α-Ketoisovaleric acid sodium salt;2-Keto-3-methylbutyric acid sodium salt;3-Methyl-2-oxobutanoic acid sodium salt;3-Methyl-2-oxobutyric acid sodium salt;Ketovaline sodium salt
CAS NO.:3715-29-5
Empirical Formula: C5H7NaO3
Molecular Weight: 138.1
MDL number: MFCD00002581
EINECS: 223-062-2
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB56.00 | In Stock |
|
| 1G | RMB200.00 | In Stock |
|
| 5G | RMB711.20 | In Stock |
|
| 25G | RMB2477.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-230 °C (dec.) (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble100mg/mL, clear, colorless |
| form | Crystalline Powder or Crystals |
| color | White or slightly yellow to beige |
| Odor | fruity |
| Water Solubility | >54.8 mg/mL in Water |
| JECFA Number | 631.1 |
| BRN | 4334552 |
| InChI | InChI=1S/C5H8O3.Na/c1-3(2)4(6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | WIQBZDCJCRFGKA-UHFFFAOYSA-M |
| SMILES | C(=O)(C([O-])=O)C(C)C.[Na+] |
| LogP | -0.36 |
| CAS DataBase Reference | 3715-29-5(CAS DataBase Reference) |
Description and Uses
Sodium 3-methyl-2-oxobutyrate (3-Methyl-2-oxobutanoic acid sodium salt) was used in the synthesis of (S)-2-hydroxy-3-methylbutanoic acid.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |


