A7474412
α-<SC>D</SC>-Glucose , 96% , 492-62-6
Synonym(s):
α-Dextrose;alpha-D -Glucose;alpha-Glucose
CAS NO.:492-62-6
Empirical Formula: C6H12O6
Molecular Weight: 180.16
MDL number: MFCD00063774
EINECS: 207-757-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB47.20 | In Stock |
|
| 500G | RMB103.20 | In Stock |
|
| 2.5KG | RMB311.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-156 °C(lit.) |
| Boiling point: | 232.96°C (rough estimate) |
| Density | 1.544g/cm3 |
| refractive index | n |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| form | solution |
| pka | 12.12±0.70(Predicted) |
| color | White |
| PH | 5.0-8.0 (25℃) |
| Odor | odorless |
| optical activity | [α]20/D +52°, c = 10 in H2O |
| Water Solubility | 450.5g/L(25 ºC) |
| λmax | λ: 260 nm Amax: 0.04 λ: 280 nm Amax: 0.04 |
| BRN | 1281608 |
| InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | WQZGKKKJIJFFOK-DVKNGEFBSA-N |
| SMILES | OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -1.880 (est) |
| CAS DataBase Reference | 492-62-6(CAS DataBase Reference) |
| CAS Number Unlabeled | 50-99-7 |
Description and Uses
α-D-Glucose is used:
- As a reducing agent in the preparation superparamagnetic ferrous oxide (Fe3O4) nanoparticles and silver nanocrystals.
- As an additive for the formation of isoporous polystyrene-block-poly(4-vinylpyridine) (PS-b-P4VP) diblock copolymer membranes.
- For glycosylation of cell-penetrating poly(disulfide)s (CPDs) with improved solubility to achieve multifunctional cellular uptake.
- As a precursor in the synthesis of metal/carbon nanohybrids under hydrothermal conditions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | LZ6600000 |
| F | 3 |
| HS Code | 17023000 |
| Storage Class | 11 - Combustible Solids |







