A7475612
<SC>L</SC>-4-Hydroxy-proline benzyl ester hydrochloride , 98.0%(HPLC) , 62147-27-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB159.20 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-165 °C |
| storage temp. | Inert atmosphere,2-8°C |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 37±2°, c = 1% in methanol |
| BRN | 3728745 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C12H15NO3.ClH/c14-10-6-11(13-7-10)12(15)16-8-9-4-2-1-3-5-9;/h1-5,10-11,13-14H,6-8H2;1H/t10-,11+;/s3 |
| InChIKey | LVYXMDJSWLEZMP-NFGOAHBONA-N |
| SMILES | [C@@H]1(NC[C@H](O)C1)C(=O)OCC1C=CC=CC=1.Cl |&1:0,3,r| |
Description and Uses
L-4-Hydroxy-proline benzyl ester, HCl
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 3-10 |
| Storage Class | 13 - Non Combustible Solids |





