A7513012
sec-Butyl chloroformate , 97% , 17462-58-7
CAS NO.:17462-58-7
Empirical Formula: C5H9ClO2
Molecular Weight: 136.58
MDL number: MFCD00043796
EINECS: 241-475-6
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 126 °C |
| Density | 1.081±0.06 g/cm3(Predicted) |
| InChI | InChI=1S/C5H9ClO2/c1-3-4(2)8-5(6)7/h4H,3H2,1-2H3 |
| InChIKey | YSMHTFWPDRJCMN-UHFFFAOYSA-N |
| SMILES | C(Cl)(OC(C)CC)=O |
| EPA Substance Registry System | sec-Butyl chloroformate (17462-58-7) |
Description and Uses
sec-Butyl Chloroformate-D3 is an intermediate in the synthesis of Picaridin-d3(P436002) which acts on certain olfactory receptor cell types to reduce the activating or attracting effect of odor sources.Insect repellent.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H315-H302-H226-H330-H318 |
| Precautionary statements | P280-P305+P351+P338-P310-P264-P280-P302+P352-P321-P332+P313-P362-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P264-P270-P301+P312-P330-P501 |
| RIDADR | UN 2742 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 2915907098 |








