A7541312
Sudan Orange G , pure , 2051-85-6
Synonym(s):
2,4-Dihydroxyazobenzene;4-(Phenylazo)resorcinol;SOG
CAS NO.:2051-85-6
Empirical Formula: C12H10N2O2
Molecular Weight: 214.22
MDL number: MFCD00002275
EINECS: 218-131-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-146 °C(lit.) |
| Boiling point: | 354.35°C (rough estimate) |
| Density | 1.2042 (rough estimate) |
| refractive index | 1.6660 (estimate) |
| storage temp. | Amber Vial, Refrigerator, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (slightly) |
| Colour Index | 11920 |
| form | Powder |
| pka | 8.77±0.18(Predicted) |
| color | Red-orange |
| Water Solubility | 0.2g/L(20 ºC) |
| λmax | 388 nm |
| BRN | 958430 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | HAIR DYEING COLORANT |
| InChI | 1S/C12H10N2O2/c15-10-6-7-11(12(16)8-10)14-13-9-4-2-1-3-5-9/h1-8,15-16H/b14-13+ |
| InChIKey | BPTKLSBRRJFNHJ-BUHFOSPRSA-N |
| SMILES | Oc1ccc(\N=N\c2ccccc2)c(O)c1 |
| LogP | 1.003 (est) |
| EPA Substance Registry System | 1,3-Benzenediol, 4-(phenylazo)- (2051-85-6) |
Description and Uses
Sudan Orange G is an oil soluble synthetic dye. Sudan Orange G can be degraded by a bacterial strain known as Pseudomonas putida MET94. Dyes and metabolites, Environmental Testing
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CZ9027500 |
| TSCA | TSCA listed |
| HS Code | 32041200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







