PRODUCT Properties
| Melting point: | 94-95℃ |
| alpha | D20 +212° (chloroform) |
| Boiling point: | 520.8±50.0 °C(Predicted) |
| Density | 1.418 |
| storage temp. | -20°C |
| solubility | Soluble in chloroform |
| form | powder |
| color | White |
| biological source | Sesamum indicum (sesame) |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C20H18O7/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)27-12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19+,20+/m0/s1 |
| InChIKey | ZZMNWJVJUKMZJY-AFHBHXEDSA-N |
| SMILES | [H][C@@]12[C@@H](C(C=C3)=CC4=C3OCO4)OC[C@]1([H])[C@@H](OC5=CC6=C(C=C5)OCO6)OC2 |
Description and Uses
Synergist for pyrethrum insecticides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| WGK Germany | WGK 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
