PRODUCT Properties
| Melting point: | -12～-11℃ |
| Boiling point: | 379.5±11.0 °C(Predicted) |
| Density | 0.92 |
| refractive index | n |
| Flash point: | 110 °C |
| storage temp. | -20°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| form | liquid |
| pka | 4.74±0.10(Predicted) |
| color | Colourless |
| biological source | synthetic |
| Merck | 14,5507 |
| BRN | 1712253 |
| Stability: | Light Sensitive |
| InChI | 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10,12-13H,2-5,8,11,14-17H2,1H3,(H,19,20)/b7-6-,10-9-,13-12- |
| InChIKey | VZCCETWTMQHEPK-QNEBEIHSSA-N |
| SMILES | CCCCC\C=C/C\C=C/C\C=C/CCCCC(O)=O |
| LogP | 6.570 (est) |
| CAS DataBase Reference | 506-26-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Gamolenic acid(506-26-3) |
Description and Uses
γ-Linolenic acid (gamma-linolenic acid or GLA, INN and USAN gamolenic acid) is a fatty acid found primarily in vegetable oils. It is sold as a dietary supplement for treating problems with inflammation and auto-immune diseases, although its efficacy is disputed.
γ-linolenic acid has been used as an analytical standard in gas chromatography. It may be used in nutritional studies regarding weight regain and as a possible tumor suppression agent. γ-linolenic acid is used in studies on the mechanisms and prevention of oxidation/peroxidation of unsaturated fatty acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HS Code | 29161500 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
