A7569058
4-Hydroxytamoxifen , 10mMinDMSO , 68047-06-3
Synonym(s):
4-OHT;(Z)-4-Hydroxytamoxifen, 4-OH-TAM, Estrogen Receptor Signaling Regulator II;cis/trans-4-Hydroxytamoxifen;4-(1-[4-(Dimethylaminoethoxy)phenyl]-2-phenyl-1-butenyl)phenol
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB774.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-107°C |
| Boiling point: | 513.45°C (rough estimate) |
| Density | 1.1005 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| solubility | 95% ethanol: 20 mg/mL |
| pka | 10.35±0.15(Predicted) |
| form | powder |
| color | white |
| Stability: | Stable. Store cool. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C26H29NO2/c1-4-25(20-8-6-5-7-9-20)26(21-10-14-23(28)15-11-21)22-12-16-24(17-13-22)29-19-18-27(2)3/h5-17,28H,4,18-19H2,1-3H3/b26-25- |
| InChIKey | TXUZVZSFRXZGTL-OCEACIFDSA-N |
| SMILES | C1(O)=CC=C(/C(/C2=CC=C(OCCN(C)C)C=C2)=C(/C2=CC=CC=C2)\CC)C=C1 |
| CAS DataBase Reference | 68047-06-3 |
Description and Uses
tamoxifen metabolite, anti-estrogen, see Tamoxifen 1,01038
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H350-H360FD-H410 |
| Precautionary statements | P201-P202-P264-P273-P301+P312-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-63 |
| Safety Statements | 22-23-36 |
| WGK Germany | 3 |
| RTECS | SL1210000 |







![alpha-[4-[2-(dimethylamino)ethoxy]phenyl]-beta-ethyl-alpha-phenylphenethyl alcohol](https://img.chemicalbook.com/CAS/GIF/748-97-0.gif)
![2-[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine](https://img.chemicalbook.com/CAS/GIF/13002-65-8.gif)
