A7580058
Loganin , 10mMinDMSO , 18524-94-2
Synonym(s):
7-Hydroxy 6-desoxyverbenalin;Loganoside
CAS NO.:18524-94-2
Empirical Formula: C17H26O10
Molecular Weight: 390.38
MDL number: MFCD00075645
EINECS: 242-398-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB328.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222°C |
| alpha | D20 -82.1° (water) |
| Boiling point: | 608.8±55.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Completely soluble in water |
| solubility | DMF: 15 mg/ml; DMSO: 10 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form | Solid |
| pka | 12.80±0.70(Predicted) |
| color | White to Almost white |
| λmax | 240nm(MeOH)(lit.) |
| Merck | 14,5560 |
| BRN | 55724 |
| Major Application | food and beverages |
| InChIKey | AMBQHHVBBHTQBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]3[C@@H](C)[C@@H](O)C[C@H]13 |
| LogP | -2.730 (est) |
| CAS DataBase Reference | 18524-94-2(CAS DataBase Reference) |
Description and Uses
Loganin is an iridoid glycoside that exhibits protective effects against hepatic injury and other diabetic complications associated with abnormal metabolic states and inflammation caused by oxidative stress and advanced glycation endproduct formation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22 |
| Safety Statements | 22-45-24/25 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| F | 3-10-23 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |




