A7584958
LinalylAcetate , 10mMinDMSO , 115-95-7
Synonym(s):
3,7-Dimethyl-1,6-octadien-3-yl acetate;Bergamol;Linalyl acetate
CAS NO.:115-95-7
Empirical Formula: C12H20O2
Molecular Weight: 196.29
MDL number: MFCD00008907
EINECS: 204-116-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85°C |
| Boiling point: | 220 °C(lit.) |
| Density | 0.901 g/mL at 25 °C(lit.) |
| vapor density | 6.8 (vs air) |
| vapor pressure | 0.1 mm Hg ( 20 °C) |
| FEMA | 2636 | LINALYL ACETATE |
| refractive index | n |
| Flash point: | 194 °F |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless |
| Odor | at 100.00 %. sweet green citrus bergamot lavender woody |
| Odor Type | herbal |
| biological source | synthetic |
| optical activity | (S)-:-9.4520 |
| Water Solubility | 499.8mg/L(25 ºC) |
| Merck | 14,5496 |
| JECFA Number | 359 |
| BRN | 1724500 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | FRAGRANCE |
| InChI | 1S/C12H20O2/c1-6-12(5,14-11(4)13)9-7-8-10(2)3/h6,8H,1,7,9H2,2-5H3 |
| InChIKey | UWKAYLJWKGQEPM-LBPRGKRZSA-N |
| SMILES | C\C(C)=C\CCC(C)(OC(C)=O)C=C |
| LogP | 3.9 at 25℃ |
| CAS DataBase Reference | 115-95-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,6-Octadien-3-ol, 3,7-dimethyl-, acetate(115-95-7) |
| EPA Substance Registry System | Linalyl acetate (115-95-7) |
Description and Uses
In perfumery.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319 |
| Precautionary statements | P261-P264-P272-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-38 |
| Safety Statements | 26-36-37-24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 1 |
| RTECS | RG5910000 |
| TSCA | TSCA listed |
| HS Code | 29153900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1B |
| Hazardous Substances Data | 115-95-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 13934 mg/kg |



