PRODUCT Properties
| Melting point: | 195°C (rough estimate) |
| Boiling point: | 437.0±47.0 °C(Predicted) |
| Density | 1.5426 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store at -20°C,unstable in solution, ready to use. |
| solubility | Soluble in DMSO |
| pka | 3.29±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| Merck | 14,4590 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C7H5Cl2NO4S/c8-10(9)15(13,14)6-3-1-5(2-4-6)7(11)12/h1-4H,(H,11,12) |
| InChIKey | XPDVQPODLRGWPL-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(cc1)S(=O)(=O)N(Cl)Cl |
| CAS DataBase Reference | 80-13-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, p-(dichlorosulfamoyl)-,(80-13-7) |
| EPA Substance Registry System | Halazone (80-13-7) |
Description and Uses
Water disinfectant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| RTECS | DG8050000 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| Storage Class | 13 - Non Combustible Solids |







