A7603358
FaropenemSodium , 10mMinDMSO , 122547-49-3
Synonym(s):
(5R,6S,8R,2′R)-2-(2′-tetrahydrofuryl)-6-hydroxyethylpenem-3-carboxylate sodium salt;Farom;Fropenem;Furopenem
CAS NO.:122547-49-3
Empirical Formula: C12H14NO5S.Na
Molecular Weight: 307.3
MDL number: MFCD07357271
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >85°C (dec.) |
| alpha | D22 +60° (c = 0.10) |
| storage temp. | -20°C |
| solubility | H2O: ≥20mg/mL |
| form | powder |
| color | white to light brown |
| optical activity | [α]/D +120 to +130°, c =1.0 in water |
| Water Solubility | H2O: ≥20mg/mL |
| Stability: | Hygroscopic |
| InChI | InChI=1/C12H15NO5S.Na/c1-5(14)7-10(15)13-8(12(16)17)9(19-11(7)13)6-3-2-4-18-6;/h5-7,11,14H,2-4H2,1H3,(H,16,17);/q;+1/p-1/t5-,6-,7+,11-;/s3 |
| InChIKey | ICSAXRANXQSPQP-WWTPKCCHNA-M |
| SMILES | N12C([C@]([H])([C@H](O)C)[C@@]1([H])SC([C@@H]1OCCC1)=C2C([O-])=O)=O.[Na+] |&1:2,4,7,11,r| |
Description and Uses
Faropenem is an orally active beta-lactam antibiotic belonging to the penem group.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |







