A7603758
3-(3-Methoxyphenyl)propionicacid , 10mMinDMSO , 10516-71-9
Synonym(s):
3-Methoxyhydrocinnamic acid
CAS NO.:10516-71-9
Empirical Formula: C10H12O3
Molecular Weight: 180.2
MDL number: MFCD00014027
EINECS: 234-049-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-45 °C (lit.) |
| Boiling point: | 318.1±17.0 °C(Predicted) |
| Density | 1.144±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| pka | pK1:4.654 (25°C) |
| form | Solid |
| color | White to light yellow |
| Water Solubility | Soluble in water. |
| BRN | 1874422 |
| InChI | InChI=1S/C10H12O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| InChIKey | BJJQJLOZWBZEGA-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=CC(OC)=C1 |
| CAS DataBase Reference | 10516-71-9(CAS DataBase Reference) |
Description and Uses
3-(3-Methoxyphenyl)propionic acid is used as pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |







