PRODUCT Properties
| Melting point: | 190-192°C |
| alpha | D20 -9° (chloroform) |
| Boiling point: | 521.49°C (rough estimate) |
| Density | 1.0389 (rough estimate) |
| vapor pressure | 0-0Pa at 25℃ |
| refractive index | 1.4890 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Practically insoluble in water, freely soluble in ethanol (96 per cent) |
| pka | pK: 5.35 in water |
| form | Solid |
| color | White to Off-White |
| optical activity | -920 (c 1, CHCl3) |
| Water Solubility | 2.376-525000μg/L at 25℃ |
| λmax | 204nm(H2O)(lit.) |
| Merck | 14,4317 |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | IECPWNUMDGFDKC-MZJAQBGESA-N |
| SMILES | [H][C@@]12CC[C@@]3(C)[C@@]([H])([C@H](O)C[C@@]4([H])\C([C@H](C[C@]34C)OC(C)=O)=C(/CC\C=C(\C)C)C(O)=O)[C@@]1(C)CC[C@@H](O)[C@H]2C |
| LogP | 2.68-6.75 at 20℃ |
| CAS DataBase Reference | 6990-06-3(CAS DataBase Reference) |
Description and Uses
Fusidic Acid: An Inhibitor of the Elongation Factor G (EF-G)
Fusidic acid is a steroidal antibiotic compound derived from the fungus Fusidium coccineum. The elongation factor G (EF-G) catalyzes the translocation of the tRNA and mRNA down the ribosome at the end of each round of polypeptide elongation. Fusidic acid binds to EF-G, preventing its release from the ribosome, thus stalling bacterial protein synthesis. Fusidic acid is mainly notable for its activity against staphylococci, whether or not they are resistant to methicillin and related penicillins. Fusidic acid was found in the culture broth of a fungus imperfectus, Fusidium coccineum, by Leo in 1962. It has a steroid structure but shows no hormonal activity.
Fusidic acid is a bacteriostatic antibiotic. Fusidic Acid suppresses nitric oxide lysis of pancreatic islet cells. Inhibits protein synthesis in prokaryotes by inhibiting the ribosome-dependent activity of G factor and translocation of peptidyl-tRNA. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | RC1350000 |
| HS Code | 29419000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 in mice (g/kg): 1.2 s.c.; 1.5 orally (Godtfredsen) |







