N-(tert-Butoxycarbonyl)-5-aminovalericAcid , 10mMinDMSO , 27219-07-4
Synonym(s):
5-(Boc-amino)pentanoic acid;5-(Boc-amino)valeric acid
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 48-52 °C(lit.) |
| Boiling point: | 160-168 °C0.8 mm Hg(lit.) |
| Density | 1.1518 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 4.72±0.10(Predicted) |
| color | Off-white |
| BRN | 2048862 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H19NO4/c1-10(2,3)15-9(14)11-7-5-4-6-8(12)13/h4-7H2,1-3H3,(H,11,14)(H,12,13) |
| InChIKey | GFMRZAMDGJIWRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(O)=O |
| CAS DataBase Reference | 27219-07-4(CAS DataBase Reference) |
Description and Uses
Boc-5-aminopentanoic acid can be used as a PROTAC linker in the synthesis of PROTACs. Boc-5-aminopentanoic acid is an alkane chain with terminal carboxlic acid and Boc-protected amino groups. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine.
Boc-5-aminovaleric acid can be used to synthesize inhibitors of bacterial quorum seining and biofilm formation. It can also be used to synthesize diblock and triblock copolymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




