PRODUCT Properties
| Melting point: | 187-190 °C(lit.) |
| alpha | -24.5 º (c=4, MeOH) |
| Boiling point: | 303.86°C (rough estimate) |
| Density | 1.1599 (rough estimate) |
| refractive index | -22 ° (C=5, EtOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethanol (Slightly), Water (Slightly, Heated) |
| pka | 3.67±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| optical activity | [α]25/D 23±3°, c = 2 in ethanol |
| Water Solubility | 0.81 g/100 mL (20 ºC) |
| BRN | 1724849 |
| Major Application | peptide synthesis |
| InChI | 1S/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t7-/m0/s1 |
| InChIKey | WXNXCEHXYPACJF-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@H](NC(C)=O)C(O)=O |
| CAS DataBase Reference | 1188-21-2(CAS DataBase Reference) |
| NIST Chemistry Reference | L-leucine, n-acetyl-(1188-21-2) |
| EPA Substance Registry System | L-Leucine, N-acetyl- (1188-21-2) |
Description and Uses
N-Acetyl-L-(-)-leucine is used in the preparation of small molecule inhibitors of anti-apoptotic Bcl-2 family proteins. Also used in the preparation of amphiphilic copolymers involving hydrophobic amino acid and oligopeptide side chains for optical tumor imaging in vivo.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29241900 |
| Storage Class | 11 - Combustible Solids |







