A7619258
Metaraminol(+)-bitartratesalt , 10mMinDMSO , 33402-03-8
Synonym(s):
(−)-m-Hydroxyphenylpropanolamine bitartrate salt;Metaraminol (+)-bitartrate salt
CAS NO.:33402-03-8
Empirical Formula: C13H19NO8
Molecular Weight: 317.29
MDL number: MFCD00238763
EINECS: 251-502-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-177° |
| storage temp. | Store at -20°C |
| solubility | DMSO:0.0(Max Conc. mg/mL);0.0(Max Conc. mM) |
| form | A solid |
| color | White to off-white |
| Stability: | Toxic |
| InChI | InChI=1S/C9H13NO2.C4H6O6/c1-6(10)9(12)7-3-2-4-8(11)5-7;5-1(3(7)8)2(6)4(9)10/h2-6,9,11-12H,10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t6-,9-;1-,2-/m01/s1 |
| InChIKey | VENXSELNXQXCNT-IJYXXVHRSA-N |
| SMILES | [C@H](O)(C(=O)O)[C@@H](O)C(=O)O.[C@H](C1C=CC=C(C=1)O)(O)[C@@H](N)C |
| CAS DataBase Reference | 33402-03-8(CAS DataBase Reference) |
Description and Uses
antiinfective
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P261-P280-P301+P330+P331+P310-P302+P352+P312-P304+P340+P311-P403+P233 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DN5160000 |
| HS Code | 2939800000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral |





