PRODUCT Properties
| Melting point: | 82-84 °C (lit.) |
| Boiling point: | 274-275 °C (lit.) |
| Density | 1.2668 (rough estimate) |
| refractive index | 1.5140 (estimate) |
| Flash point: | 274-275°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 2218156 |
| InChI | InChI=1S/C11H14O5/c1-13-8-5-7(11(12)16-4)6-9(14-2)10(8)15-3/h5-6H,1-4H3 |
| InChIKey | KACHFMOHOPLTNX-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(OC)=C(OC)C(OC)=C1 |
| LogP | 1.740 (est) |
| CAS DataBase Reference | 1916-07-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 3,4,5-trimethoxy-, methyl ester(1916-07-0) |
| EPA Substance Registry System | Benzoic acid, 3,4,5-trimethoxy-, methyl ester (1916-07-0) |
Description and Uses
Trimebutine (T795605) impurity standard.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DI0820000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29189900 |
