PRODUCT Properties
| Melting point: | 82-84 °C (lit.) | 
                                    
| Boiling point: | 274-275 °C (lit.) | 
                                    
| Density | 1.2668 (rough estimate) | 
                                    
| refractive index | 1.5140 (estimate) | 
                                    
| Flash point: | 274-275°C | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| color | White to Off-White | 
                                    
| BRN | 2218156 | 
                                    
| InChI | InChI=1S/C11H14O5/c1-13-8-5-7(11(12)16-4)6-9(14-2)10(8)15-3/h5-6H,1-4H3 | 
                                    
| InChIKey | KACHFMOHOPLTNX-UHFFFAOYSA-N | 
                                    
| SMILES | C(OC)(=O)C1=CC(OC)=C(OC)C(OC)=C1 | 
                                    
| LogP | 1.740 (est) | 
                                    
| CAS DataBase Reference | 1916-07-0(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | Benzoic acid, 3,4,5-trimethoxy-, methyl ester(1916-07-0) | 
                                    
| EPA Substance Registry System | Benzoic acid, 3,4,5-trimethoxy-, methyl ester (1916-07-0) | 
                                    
Description and Uses
Trimebutine (T795605) impurity standard.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P271-P280 | 
| Hazard Codes | Xi | 
| Safety Statements | 24/25 | 
| WGK Germany | 3 | 
| RTECS | DI0820000 | 
| Hazard Note | Irritant | 
| TSCA | Yes | 
| HS Code | 29189900 | 







