A7625358
Hydrocortisone21-acetate , 10mMinDMSO , 50-03-3
Synonym(s):
11β,17α,21-Trihydroxy-4-pregnene-3,20-dione 21-acetate;17-α-Hydroxycorticosterone acetate;17-Hydroxycorticosterone 21-acetate;21-Acetoxy-4-pregnene-11β,17α-diol-3,20-dione;4-Pregnene-11β,17α,21-triol-3,20-dione 21-acetate
CAS NO.:50-03-3
Empirical Formula: C23H32O6
Molecular Weight: 404.5
MDL number: MFCD00037714
EINECS: 200-004-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223 °C (dec.)(lit.) |
| alpha | D25 +166° (c = 0.4 in dioxane); D25 +150.7° (c = 0.5 in acetone) |
| Boiling point: | 446.1°C (rough estimate) |
| Density | d420 1.289 |
| refractive index | 1.4593 (estimate) |
| Flash point: | 223°C |
| storage temp. | 0-6°C |
| solubility | Practically insoluble in water, slightly soluble in anhydrous ethanol and in methylene chloride |
| pka | 12.42±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| Decomposition | 223 ºC |
| Merck | 14,4787 |
| BRN | 2066841 |
| Stability: | Stable, but may be light or moisture sensitive. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | ALEXXDVDDISNDU-JZYPGELDSA-N |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]4(C)[C@@]2([H])CC[C@]4(O)C(=O)COC(C)=O |
| LogP | 2.190 |
| CAS DataBase Reference | 50-03-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Hydrocortisone acetate(50-03-3) |
Description and Uses
Glucocorticoid
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360Df-H373 |
| Precautionary statements | P202-P260-P280-P308+P313-P405-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T |
| Risk Statements | 63-10-45 |
| Safety Statements | 36/37-45-53 |
| WGK Germany | 3 |
| RTECS | GM8960000 |
| HS Code | 29372100 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B STOT RE 2 |
| Toxicity | LD50 intraperitoneal in mouse: 2300mg/kg |




