A7631212
Tin 2-ethylhexanoate , 95% , 301-10-0
Synonym(s):
2-Ethylhexanoic acid tin(II) salt;Stannous 2-ethylhexanoate;Stannous octoate
CAS NO.:301-10-0
Empirical Formula: C16H30O4Sn
Molecular Weight: 405.12
MDL number: MFCD00002676
EINECS: 206-108-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-20°C |
| Boiling point: | >200°C |
| Density | 1.251 g/mL at 25 °C(lit.) |
| vapor pressure | 0.3Pa at 20℃ |
| refractive index | n |
| Flash point: | >110°C |
| pka | 5.09[at 20 ℃] |
| form | liquid |
| Specific Gravity | 1.251 |
| Water Solubility | Miscible with water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/2C8H16O2.Sn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | KSBAEPSJVUENNK-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)C(=O)O[SnH2]OC(=O)C(CC)CCCC |
| LogP | 2.64 at 25℃ |
| CAS DataBase Reference | 301-10-0(CAS DataBase Reference) |
| EPA Substance Registry System | Stannous 2-ethylhexanoate (301-10-0) |
Description and Uses
A catalyst for polylactide polymerization.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H318-H361-H412 |
| Precautionary statements | P201-P273-P280-P302+P352-P305+P351+P338-P308+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-62-52/53-43-41-63 |
| Safety Statements | 26-36/37/39-61 |
| WGK Germany | 1 |
| RTECS | MO7870000 |
| TSCA | TSCA listed |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 Repr. 1B Skin Sens. 1 |








