A7640712
Tris(4-nitrophenyl)amine , 97% , 20440-93-1
CAS NO.:20440-93-1
Empirical Formula: C18H12N4O6
Molecular Weight: 380.31
MDL number: MFCD00024636
EINECS: 606-557-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100G | RMB808.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 594.0±45.0 °C(Predicted) |
| Density | 1.484±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Very Slightly, Heated, Sonicated, Partially Dissolved) |
| form | Solid |
| pka | -12.56±0.50(Predicted) |
| color | Brown to Very Dark Brown |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C18H12N4O6/c23-20(24)16-7-1-13(2-8-16)19(14-3-9-17(10-4-14)21(25)26)15-5-11-18(12-6-15)22(27)28/h1-12H |
| InChIKey | LSNJBIDKQIRWRQ-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=C([N+]([O-])=O)C=C2)C2=CC=C([N+]([O-])=O)C=C2)=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 20440-93-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 4-nitro-N,N-bis(4-nitrophenyl)- (20440-93-1) |
Description and Uses
Tris(p-nitrophenyl)amine (cas# 20440-93-1) is a compound useful in organic synthesis. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2921490090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





