A7641112
2,2,4-Trimethyl-1,3-pentanediol diisobutyrate , 98.5% , 6846-50-0
Synonym(s):
1-Isopropyl-2,2-dimethyltrimethylene diisobutyrate
CAS NO.:6846-50-0
Empirical Formula: C16H30O4
Molecular Weight: 286.41
MDL number: MFCD00059267
EINECS: 229-934-9
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB43.20 | In Stock |
|
| 500ML | RMB94.40 | In Stock |
|
| 2.5L | RMB439.20 | In Stock |
|
| 10L | RMB1231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −70 °C(lit.) |
| Boiling point: | 280 °C(lit.) |
| Density | 0.941 g/mL at 25 °C(lit.) |
| vapor pressure | 1.5Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless |
| explosive limit | 0.48%, 172°F |
| Water Solubility | 13mg/L at 25℃ |
| Merck | 14,9251 |
| Cosmetics Ingredients Functions | PLASTICISER |
| InChI | 1S/C16H30O4/c1-10(2)13(20-15(18)12(5)6)16(7,8)9-19-14(17)11(3)4/h10-13H,9H2,1-8H3 |
| InChIKey | OMVSWZDEEGIJJI-UHFFFAOYSA-N |
| SMILES | CC(C)C(OC(=O)C(C)C)C(C)(C)COC(=O)C(C)C |
| LogP | 4.91 at 25℃ |
| CAS DataBase Reference | 6846-50-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2,2,4-Trimethyl-1,3-pentanediol diisobutyrate (6846-50-0) |
Description and Uses
In manufacture of vinyl flooring, toys and other vinyl products.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361d-H412 |
| Precautionary statements | P202-P273-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | SA1420000 |
| Autoignition Temperature | 795 °F |
| TSCA | TSCA listed |
| HS Code | 29156019 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 Repr. 2 |
| Hazardous Substances Data | 6846-50-0(Hazardous Substances Data) |






