A7643058
LevistilideA , 10mMinDMSO , 88182-33-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB430.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C |
| Boiling point: | 623.8±55.0 °C(Predicted) |
| Density | 1.23 |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Cryst. |
| color | White to off-white |
| Cosmetics Ingredients Functions | SKIN PROTECTING SKIN CONDITIONING |
| InChIKey | UBBRXVRQZJSDAK-ZJHGLIIDSA-N |
| SMILES | O1C(=O)C2=C[C@@]3([H])CC[C@@]2([C@@]2([H])C4C(=O)O/C(=C\CCC)/C=4CC[C@@]32[H])/C/1=C/CCC |
Description and Uses
Levistilide A inhibits rhythmic uterine contractions and can be used to treat liver fibrosis or cirrhosis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Safety Statements | 24/25 |
| HS Code | 29322090 |
