A7643712
3,3,5,5-Tetrabromobisphenol A , 98% , 79-94-7
Synonym(s):
4,4′-Isopropylidenebis(2,6-dibromophenol);TBBPA
CAS NO.:79-94-7
Empirical Formula: C15H12Br4O2
Molecular Weight: 543.87
MDL number: MFCD00013962
EINECS: 201-236-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB60.80 | In Stock |
|
| 500G | RMB160.80 | In Stock |
|
| 2.5KG | RMB604.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-181 °C(lit.) |
| Boiling point: | 316 °C |
| Density | 2.1 |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5000 (estimate) |
| storage temp. | 2-8°C |
| solubility | Insoluble |
| pka | 8.50±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Insoluble |
| BRN | 1889048 |
| Major Application | environmental |
| InChI | 1S/C15H12Br4O2/c1-15(2,7-3-9(16)13(20)10(17)4-7)8-5-11(18)14(21)12(19)6-8/h3-6,20-21H,1-2H3 |
| InChIKey | VEORPZCZECFIRK-UHFFFAOYSA-N |
| SMILES | CC(C)(c1cc(Br)c(O)c(Br)c1)c2cc(Br)c(O)c(Br)c2 |
| LogP | 5.903-6.31 at 12-25℃ |
| CAS DataBase Reference | 79-94-7(CAS DataBase Reference) |
| IARC | 2A (Vol. 115) 2018 |
| NIST Chemistry Reference | Phenol, 4,4'-(2,2-propanediyl) bis[2,6-dibromo]-(79-94-7) |
| EPA Substance Registry System | Tetrabromobisphenol A (79-94-7) |
Description and Uses
tetrabromobisphenol A is widely used as a reactive flame retardant to produce a bromine-containing epoxy resin and polycarbonate, and as intermediates for the synthesis of other complex flame retardant, also as an additive flame retardant for ABS, HIPS, unsaturated polyester rigid polyurethane foams, adhesives and coatings.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P501 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53 |
| Safety Statements | 26-36-37/39-61-60 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 1 |
| RTECS | SM0894500 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | II |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
| Hazardous Substances Data | 79-94-7(Hazardous Substances Data) |
| Toxicity | LD50 inhalation in guinea pig: > 500mg/m3/8H |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






