A7645858
Estropipate , 10mMinDMSO , 7280-37-7
Synonym(s):
3-(Sulfooxy)-estra-1,3,5(10)-trien-17-one : piperazine (1:1);Estrone sulfate piperazine salt;Estropipate;Harmogen;Ogen
CAS NO.:7280-37-7
Empirical Formula: C22H32N2O5S
Molecular Weight: 436.56
MDL number: MFCD00867399
EINECS: 230-696-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245 °C |
| alpha | D25 +87.8° (c = 1 in 0.4% NaOH) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥24mg/mL |
| pka | pKa 3.6/9.7(acetonitrile,80% v/v) (Uncertain) |
| form | powder |
| color | white to tan |
| optical activity | [α]/D 100 to 120°, c = 1 in DMSO |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | HZEQBCVBILBTEP-ZFINNJDLSA-N |
| SMILES | C1CNCCN1.C[C@]23CC[C@H]4[C@@H](CCc5cc(OS(O)(=O)=O)ccc45)[C@@H]2CCC3=O |
| CAS DataBase Reference | 7280-37-7(CAS DataBase Reference) |
Description and Uses
Estrogen.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H350 |
| Precautionary statements | P201-P301+P312+P330-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 45-22 |
| Safety Statements | 53-45 |
| WGK Germany | 3 |
| RTECS | KG7785000 |
| HS Code | 2937230000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1A |





