A7648758
Lactobionicacid , 10mMinDMSO , 96-82-2
Synonym(s):
4-O-β-D -Galactopyranosyl-D -gluconic acid
CAS NO.:96-82-2
Empirical Formula: C12H22O12
Molecular Weight: 358.3
MDL number: MFCD00078147
EINECS: 202-538-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-118 °C(lit.) |
| alpha | 22.8 º (c=10, H2O) |
| Boiling point: | 410.75°C (rough estimate) |
| Density | 1.4662 (rough estimate) |
| refractive index | 26 ° (C=8.8, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 10 g/100 mL |
| form | Powder |
| pka | 3.28±0.35(Predicted) |
| color | White to Off-white |
| biological source | synthetic |
| optical activity | [α]20/D +25°, c = 10 in H2O |
| Water Solubility | 10 g/100 mL |
| Merck | 5342 |
| BRN | 95054 |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | 1S/C12H22O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h3-10,12-20H,1-2H2,(H,21,22)/t3-,4-,5+,6+,7-,8-,9-,10-,12+/m1/s1 |
| InChIKey | JYTUSYBCFIZPBE-AMTLMPIISA-N |
| SMILES | OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)C(O)=O |
| LogP | -3.848 (est) |
| CAS DataBase Reference | 96-82-2(CAS DataBase Reference) |
Description and Uses
Lactobionic acid is mainly used in preservation solutions for organ transplantation. It is used to produce erythromycine lactobionate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 1 |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |





