PRODUCT Properties
| Melting point: | 284-285 °C |
| Boiling point: | 555.1±50.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO : 10 mg/mL (21.99 mM; Need ultrasonic and warming) |
| form | powder to crystal |
| pka | 4.68±0.70(Predicted) |
| color | White to Almost white |
| InChIKey | MUCRYNWJQNHDJH-OADIDDRXSA-N |
| SMILES | C1(=O)[C@@]([C@]2([C@](C)(CC1)[C@]1([H])[C@@]([C@]3(C(=CC1)[C@]1([C@@](CC[C@H]([C@@H]1C)C)(C(O)=O)CC3)[H])C)(C)CC2)[H])(C)C |
| CAS DataBase Reference | 6246-46-4 |
Description and Uses
Ursonic acid (UNA) is a phytochemical which can be also extracted from a great variety of traditional medicinal herbs. It can be used as a cosmetics additive and serve as a starting material for synthesis of more potent bioactive derivatives, such as experimental antitumor agents. Ursonic acid induces the apoptosis of human cancer cells through multiple signaling pathways.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2918.30.9000 |
