A7652212
Tributylmethylammonium chloride , 75wt.%inH2O , 56375-79-2
Synonym(s):
Methyltributylammonium chloride;Methyltributylammonium chloride polymer-bound;Methyltributylammonium chloride solution;Tributylammoniomethyl-polystyrene crosslinked with divinylbenzene
CAS NO.:56375-79-2
Empirical Formula: C13H30ClN
Molecular Weight: 235.84
MDL number: MFCD00011847
EINECS: 260-135-8
| Pack Size | Price | Stock | Quantity |
| 100G | RMB62.40 | In Stock |
|
| 250g | RMB151.20 | In Stock |
|
| 500G | RMB247.20 | In Stock |
|
| 2.5KG | RMB1213.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-99 °C |
| Boiling point: | 84-85°C 101mm |
| Density | 0,964 g/cm3 |
| vapor pressure | 7.9 mmHg ( 25 °C) |
| refractive index | n20/D 1.4682 |
| Flash point: | 84-85°C/101mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 6300212 |
| InChI | 1S/C13H30N.ClH/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;/h5-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IPILPUZVTYHGIL-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCC[N+](C)(CCCC)CCCC |
| LogP | -2--0.842 at 20-25℃ |
| CAS DataBase Reference | 56375-79-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanaminium, N,N-dibutyl-N-methyl-, chloride (56375-79-2) |
Description and Uses
Tributylmethylammonium chloride solution is used as a phase transfer catalyst in the synthesis of ɛ-caprolactone by Baeyer-Villiger oxidation of cyclohexanone in the presence of KHSO5 as an oxidizing agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-36-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-36/37 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29211990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |




