PRODUCT Properties
| Melting point: | 207-208 °C(Solv: ethyl ether (60-29-7); acetone (67-64-1)) |
| Boiling point: | 500.4±50.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.00±0.70(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C22H30O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h11-12,16-18,25H,5-10H2,1-4H3/t16-,17+,18+,20-,21+,22+/m1/s1 |
| InChIKey | VXIMPSPISRVBPZ-NWUMPJBXSA-N |
| SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@](O)(C(=O)C)CC3)C=C2C |
| CAS DataBase Reference | 3562-63-8(CAS DataBase Reference) |
Description and Uses
Megestrol is an orally active progestogen. Megestrol is used in combinations as oral contraceptive and as antineoplastic agent.
Safety
| Hazardous Substances Data | 3562-63-8(Hazardous Substances Data) |






