PRODUCT Properties
| Melting point: | 135 °C |
| Boiling point: | 232°C |
| Density | 0.965 |
| refractive index | 1.4367 (estimate) |
| Flash point: | 232°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO:135.0(Max Conc. mg/mL);1334.66(Max Conc. mM) Ethanol:20.0(Max Conc. mg/mL);197.73(Max Conc. mM) Water:20.0(Max Conc. mg/mL);197.73(Max Conc. mM) |
| form | White Crystalline flakes |
| pka | 16.72±0.40(Predicted) |
| color | White to off-white |
| Merck | 14,5230 |
| BRN | 1740789 |
| InChI | InChI=1S/C5H11NO/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H2,6,7) |
| InChIKey | SANOUVWGPVYVAV-UHFFFAOYSA-N |
| SMILES | C(N)(=O)CC(C)C |
| CAS DataBase Reference | 541-46-8(CAS DataBase Reference) |
| EPA Substance Registry System | Butanamide, 3-methyl- (541-46-8) |
Description and Uses
RT transferase inhibitor, antiviral
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| RTECS | EJ3650000 |
| TSCA | TSCA listed |
| HS Code | 2924190090 |






