A7655712
                    Tetramethylammonium bisulfate , 99% , 80526-82-5
CAS NO.:80526-82-5
Empirical Formula: C4H13NO4S
Molecular Weight: 171.22
MDL number: MFCD00036149
EINECS: 279-490-5
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB28.00 | In Stock | 
                                                 | 
                                        
| 5G | RMB78.40 | In Stock | 
                                                 | 
                                        
| 25G | RMB223.20 | In Stock | 
                                                 | 
                                        
| 100G | RMB736.80 | In Stock | 
                                                 | 
                                        
| 500g | RMB2528.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 295-297 °C | 
                                    
| storage temp. | Inert atmosphere,Room Temperature | 
                                    
| Water Solubility | almost transparency in Water | 
                                    
| form | Powder | 
                                    
| color | White to off-white | 
                                    
| Odor | Odorless | 
                                    
| λmax | λ: 210 nm Amax: 0.05 λ: 220 nm Amax: 0.04 λ: 230 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02  | 
                                    
| BRN | 4829202 | 
                                    
| InChI | InChI=1S/C4H12N.H2O4S/c2*1-5(2,3)4/h1-4H3;(H2,1,2,3,4)/q+1;/p-1 | 
                                    
| InChIKey | DWTYPCUOWWOADE-UHFFFAOYSA-M | 
                                    
| SMILES | [N+](C)(C)(C)C.[O-]S(O)(=O)=O | 
                                    
| CAS DataBase Reference | 80526-82-5(CAS DataBase Reference) | 
                                    
Description and Uses
Tetramethylammonium hydrogensulfate, sometimes abbreviated as TMAHS, is a quaternary ammonium salt commonly used as a catalyst and phase transfer agent in chemical reactions, especially in organic synthesis. In addition, it is used as an electrolyte additive in electrochemical and rechargeable batteries. TMAHSs have also been investigated for their potential use in various applications such as wastewater treatment, gas separation, and fuel cells.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 37/39-26 | 
| WGK Germany | 3 | 
| F | 3 | 
| HS Code | 29239000 | 




