A7657912
m-Tolylboronic acid , 97% , 17933-03-8
Synonym(s):
3-Tolylboronic acid;3-Methylphenylboronic acid;m-Boronotoluene;m-Methylbenzeneboronic acid;m-Methylphenylboronic acid
CAS NO.：17933-03-8
Empirical Formula: C7H9BO2
Molecular Weight: 135.96
MDL number: MFCD00040198
EINECS: 605-855-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB48.00 | In Stock |
|
| 25G | RMB124.00 | In Stock |
|
| 100G | RMB342.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-162 °C(lit.) |
| Boiling point: | 290.4±33.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| pka | 8.63±0.10(Predicted) |
| form | Powder and Chunks |
| color | Beige |
| BRN | 2935968 |
| InChI | InChI=1S/C7H9BO2/c1-6-3-2-4-7(5-6)8(9)10/h2-5,9-10H,1H3 |
| InChIKey | BJQCPCFFYBKRLM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(C)=C1)(O)O |
| CAS DataBase Reference | 17933-03-8(CAS DataBase Reference) |
Description and Uses
3-methylphenylboronic acid can be used in Suzuki coupling reactions and is studied in the field of chemical engineering.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | ED7788888 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
