PRODUCT Properties
| Melting point: | 158-159 °C(lit.) |
| Boiling point: | 217.07°C (rough estimate) |
| Density | 1.1816 (rough estimate) |
| refractive index | 1.4611 (estimate) |
| RTECS | DH2270000 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 3.22±0.10(Predicted) |
| color | Off-white to beige |
| InChI | InChI=1S/C8H8O4/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,9H,1H3,(H,10,11) |
| InChIKey | MRIXVKKOHPQOFK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OC)C=C1O |
| LogP | 2.240 (est) |
| CAS DataBase Reference | 2237-36-7(CAS DataBase Reference) |
Description and Uses
2-Hydroxy-4-methoxybenzoic acid (4-methoxysalicylic acid) was used in the synthesis of 1,3,4-oxadiazole derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29189900 |
