PRODUCT Properties
| Melting point: | 252-255 °C |
| Boiling point: | 582.0±50.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| pka | 4.20±0.60(Predicted) |
| color | White to Off-White |
| Stability: | Light sensitive |
| InChIKey | SEEGHKWOBVVBTQ-UYDGZXIYNA-N |
| SMILES | C([C@@H]1[C@]23CC(=C)[C@]([H])(CC[C@@]2([H])[C@@]24C=C[C@H](O)[C@](C(=O)O2)(C)[C@@]14[H])C3)(=O)O |&1:1,2,6,10,12,15,17,22,r| |
| EPA Substance Registry System | Gibberellin A7 (510-75-8) |
Description and Uses
Gibberellin A7 is an plant hormone that was isolated from culture filtrates of the fungus Gibberella fujikuroi. Gibberellin A7 was shown to promote the growth and elongation of cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |



