A7661512
Tetrabutylammonium bromide , AR,99.0% , 1643-19-2
Synonym(s):
TBAB;Tetra-n-butylammonium bromide
CAS NO.:1643-19-2
Empirical Formula: C16H36BrN
Molecular Weight: 322.37
MDL number: MFCD00011633
EINECS: 216-699-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB48.80 | In Stock |
|
| 500G | RMB89.60 | In Stock |
|
| 2.5KG | RMB303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-106 °C(lit.) |
| Boiling point: | 102 °C |
| bulk density | 700kg/m3 |
| Density | 1.039 g/mL at 25 °C |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n20/D 1.422 |
| Flash point: | 100℃ |
| storage temp. | Store below +30°C. |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder |
| pka | 0[at 20 ℃] |
| Specific Gravity | 1.007 |
| color | White to slightly cream |
| Odor | Amine like |
| PH | 3.5 to 7.0 (50 g/L, 25 ℃) |
| Water Solubility | 600 g/L (20 ºC) |
| λmax | λ: 240 nm Amax: 0.04 λ: 250 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| Sensitive | Hygroscopic |
| BRN | 3570983 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| Cosmetics Ingredients Functions | ANTIMICROBIAL ANTISTATIC |
| InChI | 1S/C16H36N.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | JRMUNVKIHCOMHV-UHFFFAOYSA-M |
| SMILES | [Br-].CCCC[N+](CCCC)(CCCC)CCCC |
| LogP | 0.839 at 25℃ |
| CAS DataBase Reference | 1643-19-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetra-N-butylammonium bromide(1643-19-2) |
| EPA Substance Registry System | Tetrabutylammonium bromide (1643-19-2) |
Description and Uses
Tetrabutylammonium Bromide is used in the synthesis of polymer solar cells. Also used in the synthesis of single component green-light emitting electrochemical cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H412 |
| Precautionary statements | P264-P270-P273-P301+P312-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 |




