A7661812
DL-Tryptophan , 99% , 54-12-6
Synonym(s):
(±)-α-Amino-3-indolepropionic acid;(±)-2-Amino-3-(3-indolyl)propionic acid;DL -3β-Indolylalanine
CAS NO.:54-12-6
Empirical Formula: C11H12N2O2
Molecular Weight: 204.23
MDL number: MFCD00064339
EINECS: 200-194-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB136.00 | In Stock |
|
| 500g | RMB615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289-290 °C (dec.)(lit.) |
| alpha | [α]D20 -1~1°(c=1, dil. HCl) |
| Boiling point: | 342.72°C (rough estimate) |
| Density | 1.1754 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | methanol: water (7:3): soluble |
| form | Powder |
| pka | 2.30±0.10(Predicted) |
| color | White to light beige or light yellow |
| Odor | Odorless |
| Water Solubility | 10 g/L (20 ºC) |
| BRN | 86196 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Cosmetics Ingredients Functions | ANTISTATIC HAIR CONDITIONING FRAGRANCE |
| InChI | 1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| InChIKey | QIVBCDIJIAJPQS-UHFFFAOYSA-N |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(O)=O |
| LogP | 1.040 (est) |
| CAS DataBase Reference | 54-12-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Tryptophane(54-12-6) |
| EPA Substance Registry System | Tryptophan (54-12-6) |
Description and Uses
DL-Tryptophan is an amino acid precursor of serotonin and melatonin. It is a dietary supplement for use as an antidepressant, anxiolytic, and sleep aid. DL-tryptophan also can be used as feed nutrition enhancer, antioxidants.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 22-36/37/38-37/38-41 |
| Safety Statements | 24/25-36/37/39-36-26 |
| WGK Germany | 1 |
| RTECS | YN6129200 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |





