A7663812
2,2,4-Trimethyl-1,3-pentanediol 1-monoisobutyrate , 99% , 25265-77-4
CAS NO.:25265-77-4
Empirical Formula: C12H24O3
Molecular Weight: 216.32
MDL number: MFCD00148967
EINECS: 246-771-9
| Pack Size | Price | Stock | Quantity |
| 500ML | RMB41.60 | In Stock |
|
| 100ML | RMB42.40 | In Stock |
|
| 1L | RMB80.80 | In Stock |
|
| 4L | RMB263.20 | In Stock |
|
| 10L | RMB655.20 | In Stock |
|
| 20L | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -50 °C (lit.) |
| Boiling point: | 255 °C (lit.) |
| Density | 0.95 g/mL at 25 °C (lit.) |
| refractive index | 1.44-1.442 |
| Flash point: | 244°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 0.95 |
| color | Colorless |
| Odor | Mild odor |
| Water Solubility | Soluble in water 900 mg/L. |
| Cosmetics Ingredients Functions | PLASTICISER |
| InChI | InChI=1S/C12H24O3/c1-8(2)10(13)12(5,6)7-15-11(14)9(3)4/h8-10,13H,7H2,1-6H3 |
| InChIKey | DAFHKNAQFPVRKR-UHFFFAOYSA-N |
| SMILES | C(C)(C)(COC(=O)C(C)C)C(O)C(C)C |
| LogP | 3.2 at 20℃ |
| CAS DataBase Reference | 25265-77-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2,2,4-Trimethylpentane-1,3-diol monoisobutyrate (25265-77-4) |
Description and Uses
2,2,4-Trimethyl-1,3-pentanediol monoisobutyrate (texanol) may be used in the prepare carbon nanotube (CNT) paste employed in field emission displays (FED).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H303 |
| Precautionary statements | P270-P301+P312-P403-P501c |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | UF6000000 |
| TSCA | TSCA listed |
| HS Code | 29156000 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | guinea pig,LD,skin,> 20mL/kg (20mL/kg),Kodak Company Reports. Vol. M-158E, Pg. 1981, |
| REACH Registrations | Active |





