A7668158
m-PEG12-amine , 10mMinDMSO , 1977493-48-3
CAS NO.：1977493-48-3
Empirical Formula: C25H53NO12
Molecular Weight: 559.69
MDL number: MFCD11041151
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB264.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 583.6±45.0 °C(Predicted) |
| Density | 1.073±0.06 g/cm3(Predicted) |
| storage temp. | -20°C, protect from light, stored under nitrogen |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| pka | 8.74±0.10(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C25H53NO12/c1-27-4-5-29-8-9-31-12-13-33-16-17-35-20-21-37-24-25-38-23-22-36-19-18-34-15-14-32-11-10-30-7-6-28-3-2-26/h2-26H2,1H3 |
| InChIKey | MSKSQCLPULZWNO-UHFFFAOYSA-N |
| SMILES | C(N)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC |
Description and Uses
m-PEG12-amine is a monodisperse PEG linker containing an amino group, It is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The hydrophilic PEG spacer increases solubility in aqueous media.
m-PEG12-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. m-PEG12-amine is also a non-cleavable 12 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[2].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
