A7669758
N-Acetylmuramyl-L-alanyl-D-isoglutaminehydrate , 10mMinDMSO , 53678-77-6
Synonym(s):
RDP;MDP;Muramyl dipeptide;Adjuvant Peptide;Dehydropeptidase-I
CAS NO.:53678-77-6
Empirical Formula: C19H32N4O11
Molecular Weight: 492.48
MDL number: MFCD00077638
EINECS: 258-696-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB363.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | D25 +44° (acetic acid) |
| Boiling point: | 1071.8±65.0 °C(Predicted) |
| Density | 1.390±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: 10 mg/mL, clear, colorless |
| form | buffered aqueous solution |
| pka | 4.44±0.10(Predicted) |
| color | White to off-white |
| Merck | 13,6329 |
| BRN | 4220745 |
| InChIKey | BSOQXXWZTUDTEL-HYUMGUTENA-N |
| SMILES | [C@H]1(O[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(=O)N)CCC(=O)O)[C@H](O)[C@H](OC(O)[C@@H]1NC(=O)C)CO |&1:0,2,7,12,21,23,27,r| |
| CAS DataBase Reference | 53678-77-6(CAS DataBase Reference) |
Description and Uses
N-Acetylmuramyl-L-alanyl-D-isoglutamine hydrate has been used in staphylococcal cell wall preparation to induce the release of TNF from human monocytes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | MA2275260 |
| F | 10 |







