A7670558
5-Iodo-2′-deoxyuridine , 10mMinDMSO , 54-42-2
Synonym(s):
Idoxuridine;IDU;5-Iodo-2′-deoxyuridine;5-IUdR;IdUrd
CAS NO.：54-42-2
Empirical Formula: C9H11IN2O5
Molecular Weight: 354.1
MDL number: MFCD00134656
EINECS: 200-207-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194 °C (lit.) |
| alpha | 280 º (c=1,1M NaOH) |
| Density | 1.7911 (estimate) |
| refractive index | 30 ° (C=1, 1mol/L NaOH) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Heated, Sonicated) |
| form | Crystalline Powder |
| pka | 8.25(at 25℃) |
| color | White to slightly beige |
| biological source | synthetic (organic) |
| optical activity | 28.4189°(C=0.8943g/100ml NAOH) |
| Water Solubility | 1.6 g/L (20 ºC) |
| Sensitive | Air & Light Sensitive |
| Merck | 14,4891 |
| BRN | 30397 |
| InChI | 1S/C9H11IN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | XQFRJNBWHJMXHO-FSDSQADBSA-N |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N2C=C(I)C(=O)NC2=O |
| CAS DataBase Reference | 54-42-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Uridine, 2'-deoxy-5-iodo-(54-42-2) |
| EPA Substance Registry System | Uridine, 2'-deoxy-5-iodo- (54-42-2) |
Description and Uses
5-Iodo-2'-deoxyuridine is a nucleoside analog that inhibits the replication of viruses and other DNA-containing organisms. 2'-Deoxy-5-iodouridine also has inhibitory properties on cell nuclei, which may be due to its ability to bind with DNA and prevent the synthesis of RNA or protein.
Idoxuridine is an antiviral agent effective against herpes-simplex infections; in ophthalmie eyedrops, ointments, and solutions.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H341-H361 |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn |
| Risk Statements | 45-46-61-40-68-62-36/37/38-63 |
| Safety Statements | 53-45-36-22-36/37-26 |
| WGK Germany | 3 |
| RTECS | YU7700000 |
| F | 8-23 |
| TSCA | TSCA listed |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Muta. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 54-42-2(Hazardous Substances Data) |
| Toxicity | LD50 i.p. in mice: 2.5 g/kg (Prusoff, 1979) |
