A7671312
3-(Trifluoromethyl)benzoyl chloride , 98% , 2251-65-2
Synonym(s):
α,α,α-Trifluoro-m-toluoyl chloride
CAS NO.：2251-65-2
Empirical Formula: C8H4ClF3O
Molecular Weight: 208.57
MDL number: MFCD00000680
EINECS: 218-844-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB341.60 | In Stock |
|
| 500g | RMB1212.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 184-186 °C/750 mmHg (lit.) |
| Density | 1.383 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | RT, stored under nitrogen |
| form | Liquid |
| Specific Gravity | 1.383 |
| color | Clear light yellow |
| Water Solubility | decomposes |
| Sensitive | Lachrymatory |
| BRN | 391266 |
| InChI | InChI=1S/C8H4ClF3O/c9-7(13)5-2-1-3-6(4-5)8(10,11)12/h1-4H |
| InChIKey | RUJYJCANMOTJMO-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 2251-65-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-(Trifluoromethyl)benzoyl chloride(2251-65-2) |
| EPA Substance Registry System | Benzoyl chloride, 3-(trifluoromethyl)- (2251-65-2) |
Description and Uses
3-(Trifluoromethyl)benzoyl chloride has been used in the preparation of intermediates, required for synthesis of C-2 and C-3 substituted pyrazolo[1,5-a]pyrimidines.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34-37-29 |
| Safety Statements | 26-36/37/39-45-8 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 19-21 |
| Hazard Note | Corrosive/Lachrymatory |
| TSCA | T |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
