A7671758
Flavone , 10mMinDMSO , 525-82-6
Synonym(s):
2-Phenyl-4H-1-benzopyran-4-one;2-Phenylchromone
CAS NO.:525-82-6
Empirical Formula: C15H10O2
Molecular Weight: 222.24
MDL number: MFCD00006825
EINECS: 208-383-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-97 °C (lit.) |
| Boiling point: | 185 °C / 1mmHg |
| Density | 1.1404 (rough estimate) |
| refractive index | 1.6600 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | >38.3 mg/mL in EtOH; >52.3 mg/mL in DMSO |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Soluble in acetone (25 mg/ml), methanol, alcohol, and chloroform. Insoluble in water. |
| Merck | 14,4092 |
| BRN | 157598 |
| InChI | InChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
| InChIKey | VHBFFQKBGNRLFZ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)OC2=CC=CC=C2C(=O)C=1 |
| LogP | 3.560 |
| CAS DataBase Reference | 525-82-6(CAS DataBase Reference) |
| EPA Substance Registry System | Flavone (525-82-6) |
Description and Uses
Flavone is a potentially useful biochemical for cytochrome P450 studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | DJ3100630 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29329990 |





