A7674512
Thorin , 90% , 3688-92-4
Synonym(s):
1-(2-Arsonophenylazo)-2-hydroxy-3,6-naphthalene-disulfonic acid sodium salt, 2-(2-Hydroxy-3,6-disulfo-1-naphthylazo)-benzene-arsonic acid sodium salt;Thorin
CAS NO.:3688-92-4
Empirical Formula: C16H11AsN2Na2O10S2
Molecular Weight: 576.3
MDL number: MFCD00003888
EINECS: 222-993-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB79.20 | In Stock |
|
| 250mg | RMB175.20 | In Stock |
|
| 1G | RMB463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| bulk density | 700kg/m3 |
| storage temp. | Store at +5°C to +30°C. |
| form | powder to crystal |
| pka | pK1:3.7;pK2:8.3;pK3:11.8 (25°C) |
| color | Orange to Brown to Dark red |
| PH | 6.1 (10g/l, H2O, 20℃) |
| Water Solubility | Soluble in water. |
| λmax | 480-490 nm (propan-2-ol) |
| InChIKey | DCSRPHQBFSYJNN-BUFQOAPZSA-L |
| SMILES | [As](=O)([O-])([O-])c1c(cccc1)N\N=C2/c3c(cc(cc3)[S](=O)(=O)O)C=C(C/2=O)[S](=O)(=O)O.[Na+].[Na+] |
| CAS DataBase Reference | 3688-92-4(CAS DataBase Reference) |
Description and Uses
Thorin, IND is a biochemical assay reagent.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H410 |
| Precautionary statements | P261-P264-P270-P273-P301+P310-P304+P340+P311 |
| Hazard Codes | T,N |
| Risk Statements | 23/25-50/53 |
| Safety Statements | 20/21-28-45-60-61 |
| RIDADR | UN 3465 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29270000 |
| Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |






