A7677412
Tributyl citrate , 98% , 77-94-1
Synonym(s):
Citric acid tributyl ester;Tributyl citrate
CAS NO.:77-94-1
Empirical Formula: C18H32O7
Molecular Weight: 360.44
MDL number: MFCD00027217
EINECS: 201-071-2
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB23.20 | In Stock |
|
| 500ML | RMB52.00 | In Stock |
|
| 2.5L | RMB175.20 | In Stock |
|
| 5L | RMB301.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C(lit.) |
| Boiling point: | 234 °C (17 mmHg) |
| Density | 1.043 g/mL at 20 °C (lit.) |
| Pour Point | -62 |
| refractive index | n |
| Flash point: | 300 °C |
| storage temp. | Store below +30°C. |
| solubility | Miscible with acetone, ethanol, and vegetable oil;
practically insoluble in water. |
| pka | 11.30±0.29(Predicted) |
| form | Liquid |
| color | Clear |
| Odor | odorless |
| Water Solubility | insoluble |
| Merck | 14,1564 |
| BRN | 1806072 |
| Cosmetics Ingredients Functions | SOLVENT PLASTICISER FILM FORMING |
| InChI | 1S/C18H32O7/c1-4-7-10-23-15(19)13-18(22,17(21)25-12-9-6-3)14-16(20)24-11-8-5-2/h22H,4-14H2,1-3H3 |
| InChIKey | ZFOZVQLOBQUTQQ-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC |
| LogP | 4.324 (est) |
| CAS DataBase Reference | 77-94-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Butyl citrate(77-94-1) |
| EPA Substance Registry System | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, tributyl ester (77-94-1) |
Description and Uses
Tributyl citrate can be used:
- To incorporate in zein film to enhance its mechanical properties for industrial processing.
- As a plasticizer to improve the ductile properties of poly(lactide) polymers.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | TZ8608000 |
| TSCA | TSCA listed |
| HS Code | 29181500 |
| Storage Class | 10 - Combustible liquids |




