PRODUCT Properties
| Melting point: | 142-148℃ |
| alpha | D20 +105° (abs alc) |
| Boiling point: | bp0.1 195-197° |
| Density | 1.1914 (rough estimate) |
| refractive index | 1.5557 (estimate) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | White to Light Yellow |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C14H14O3/c1-16-13-9-12(17-14(15)10-13)8-7-11-5-3-2-4-6-11/h2-8,10,12H,9H2,1H3/b8-7+/t12-/m0/s1 |
| InChIKey | XEAQIWGXBXCYFX-GUOLPTJISA-N |
| SMILES | C1(=O)O[C@@H](/C=C/C2=CC=CC=C2)CC(OC)=C1 |
| LogP | 0.784 (est) |
Description and Uses
Kawain is a plant extract that shows antioxidant activity through cyclooxygenase enzyme inhibition. May also be active in tumor suppression and apoptotic induction.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2932202000 |
