PRODUCT Properties
| Melting point: | 136-138 °C |
| Boiling point: | 437.9±45.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | -20°C, protect from light |
| solubility | DMSO : 50 mg/mL (204.67 mM; Need ultrasonic) |
| form | powder |
| color | Beige |
| Major Application | food and beverages |
| InChI | 1S/C15H16O3/c1-9-4-3-5-11-7-13(18-15(11)16)14-10(2)8-17-12(14)6-9/h4,7-8,13H,3,5-6H2,1-2H3/b9-4+/t13-/m1/s1 |
| InChIKey | LWCKQMHMTSRRAA-QGQQYVBWSA-N |
| SMILES | [o]1c2c(c(c1)C)[C@@H]3OC(=O)C(=C3)CC\C=C(\C2)/C |
Description and Uses
food and beverages
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
