A7682958
Octreotideacetate,SMS201995 , 10mMinWater , 79517-01-4
Synonym(s):
SMS 201-995
CAS NO.:79517-01-4
Empirical Formula: C51H70N10O12S2
Molecular Weight: 1079.3
MDL number: MFCD08277638
EINECS: 616-695-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB757.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-156°C |
| alpha | D20 -42° (c = 0.5 in 95% acetic acid) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: soluble |
| form | Solid |
| color | White to Off-White |
| Sequence | {d-Phe}-Cys-Phe-{d-Trp}-Lys-Thr-{Cys(X)}-{Thr(deoxy)} (disulfide bridge: Cys2-Cys7) (X=N-(1R,2R)-2-hydroxy-1-(hydroxymethyl)propyl) |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical |
| InChIKey | XQEJFZYLWPSJOV-XJQYZYIXSA-N |
| SMILES | S1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C1)C(=O)N[C@@H]([C@H](O)C)CO)C(O)C)CCCCN)Cc4c5c([nH]c4)cccc5)Cc3ccccc3)NC(=O)C(N)Cc2ccccc2.OC(=O)C.OC(=O)C |
| CAS DataBase Reference | 79517-01-4 |
Description and Uses
Octreotide acetate USP (Sandostatin) is used to treat Mestastatic carcinoid tumors; vasoactive intestinal peptide-secretory tumors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2937190000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | TDLo scu-man: 2587 mg/kg:GIT,LVR LANCAO348,1668,1996 |






